cas: 28987-46-4 — see every product listed under this CAS number, including other names
4-Fluoro-2-isopropoxy-1-nitrobenzene (CAS 28987-46-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210369-1G |
| cas | 28987-46-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5121.13 Pln | |
| Fluorochem | 5g | 22870.09 Pln |
| delivery time | 3-4 weeks |
|---|
4-fluoro-1-nitro-2-propan-2-yloxybenzene (CAS 28987-46-4) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: 4-fluoro-1-nitro-2-propan-2-yloxybenzene. InChIKey: SLRNETDLLJMLMR-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 4-fluoro-1-nitro-2-propan-2-yloxybenzene |
| InChIKey | SLRNETDLLJMLMR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)