cas: 123572-62-3 — see every product listed under this CAS number, including other names
4-Fluoro-2-nitro-1-(trifluoromethoxy)benzene, 98% (CAS 123572-62-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215308-1G |
| cas | 123572-62-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 10g | 508.17 Pln | |
| Fluorochem | 25g | 1185.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-2-nitro-1-(trifluoromethoxy)benzene (CAS 123572-62-3) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 4-fluoro-2-nitro-1-(trifluoromethoxy)benzene. InChIKey: PGISCPIWSHGJJJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 4-fluoro-2-nitro-1-(trifluoromethoxy)benzene |
| InChIKey | PGISCPIWSHGJJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)