cas: 2235384-35-5 — see every product listed under this CAS number, including other names
4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2235384-35-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694338-5G |
| cas | 2235384-35-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1231.88 Pln | |
| Fluorochem | 10g | 2033.68 Pln |
| delivery time | 3-4 weeks |
|---|
4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2235384-35-5) is a chemical compound with the molecular formula C13H16BFO4 and a molecular weight of 266.07 g/mol. IUPAC name: 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: QEPDYRIGALCVFX-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO4 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | QEPDYRIGALCVFX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)