CAS 2235384-35-5 appears in our catalog under these names: 5-Carboxy-2-fluorophenylboronic acid pinacol ester, 96%, 4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 96%, 4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg.
4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2235384-35-5) is a chemical compound with the molecular formula C13H16BFO4 and a molecular weight of 266.07 g/mol. IUPAC name: 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: QEPDYRIGALCVFX-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO4 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | QEPDYRIGALCVFX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)