CAS 867256-77-7 appears in our catalog under these names: 4-Carboxy-3-fluorobenzeneboronic acid pinacol ester, 95-<97%, 4-Carboxy-3-fluorobenzeneboronic acid pinacol ester, ≥97-<99%, 4–CarBoxy–3–fluoroBenzeneBoronicacid,pinacolester, 2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 98%, Benzoic acid, 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 200mg.
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 867256-77-7) is a chemical compound with the molecular formula C13H16BFO4 and a molecular weight of 266.07 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: BZWWFDHWZHGLFH-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO4 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | BZWWFDHWZHGLFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)