cas: 481681-02-1 — see every product listed under this CAS number, including other names
4-Fluoro-3-(hydroxymethyl)phenylboronic acid, 98%, 98% (CAS 481681-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0PF-100mg |
| cas | 481681-02-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-fluoro-3-(hydroxymethyl)phenyl]boronic acid (CAS 481681-02-1) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [4-fluoro-3-(hydroxymethyl)phenyl]boronic acid. InChIKey: PWMOQHMTXJYUGE-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [4-fluoro-3-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | PWMOQHMTXJYUGE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CO)(O)O |
Computed by PubChem (NCBI)