cas: 182344-23-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-(trifluoromethyl)phenylboronic Acid, 95%, 95% (CAS 182344-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134OY-1g |
| cas | 182344-23-6 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 698.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 182344-23-6) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [4-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: GUJYFCBXDUPORN-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [4-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GUJYFCBXDUPORN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)