cas: 182344-23-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-(trifluoromethyl)phenylboronic acid 95% (CAS 182344-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A432221-1g |
| cas | 182344-23-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 804.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A432221 |
[4-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 182344-23-6) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [4-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: GUJYFCBXDUPORN-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [4-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GUJYFCBXDUPORN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)