CAS 850411-12-0 appears in our catalog under these names: 3-Fluoro-2-(trifluoromethyl)phenylboronic acid, 97%, Boronic acid, B-[3-fluoro-2-(trifluoromethyl)phenyl]-, 98%, 98%, (3-Fluoro-2-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[3-fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS 850411-12-0) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [3-fluoro-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: BGSVFTCXIJCNOU-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [3-fluoro-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | BGSVFTCXIJCNOU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)