cas: 177363-10-9 — see every product listed under this CAS number, including other names
4-Fluoro-3-iodonitrobenzene, 97% (CAS 177363-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035091-250MG |
| cas | 177363-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1237.08 Pln | |
| Fluorochem | 100g | 4787.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-fluoro-2-iodo-4-nitrobenzene (CAS 177363-10-9) is a chemical compound with the molecular formula C6H3FINO2 and a molecular weight of 267.00 g/mol. IUPAC name: 1-fluoro-2-iodo-4-nitrobenzene. InChIKey: XSFIPDPCQOJJFR-UHFFFAOYSA-N.
| Molecular formula | C6H3FINO2 |
|---|---|
| Molecular weight | 267.00 g/mol |
| IUPAC name | 1-fluoro-2-iodo-4-nitrobenzene |
| InChIKey | XSFIPDPCQOJJFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)F |
Computed by PubChem (NCBI)