cas: 115812-96-9 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitropyridine, 98% (CAS 115812-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A526228-100mg |
| cas | 115812-96-9 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1111.60 Pln | |
| AmBeed | 5g | 15726.55 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-fluoro-3-nitropyridine (CAS 115812-96-9) is a chemical compound with the molecular formula C5H3FN2O2 and a molecular weight of 142.09 g/mol. IUPAC name: 4-fluoro-3-nitropyridine. InChIKey: ITEDEJJEXBFZGM-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O2 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | 4-fluoro-3-nitropyridine |
| InChIKey | ITEDEJJEXBFZGM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)