CAS 113269-06-0 appears in our catalog under these names: 4-Fluoro-5-nitrobenzene-1,2-diamine, 97% , 4-Fluoro-5-nitrobenzene-1,2-diamine, 97%, 97%, 4-Fluoro-5-nitrobenzene-1,2-diamine, 97%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g, 25g.
4-fluoro-5-nitrobenzene-1,2-diamine (CAS 113269-06-0) is a chemical compound with the molecular formula C6H6FN3O2 and a molecular weight of 171.13 g/mol. IUPAC name: 4-fluoro-5-nitrobenzene-1,2-diamine. InChIKey: QZNALIMEKAACKP-UHFFFAOYSA-N.
| Molecular formula | C6H6FN3O2 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 4-fluoro-5-nitrobenzene-1,2-diamine |
| InChIKey | QZNALIMEKAACKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)N)N |
Computed by PubChem (NCBI)