Products 147285-79-8

CAS 147285-79-8 is the registry number for 4-fluoro-3-nitro-benzene-1,2-diamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-3-nitrobenzene-1,2-diamine (CAS 147285-79-8) is a chemical compound with the molecular formula C6H6FN3O2 and a molecular weight of 171.13 g/mol. IUPAC name: 4-fluoro-3-nitrobenzene-1,2-diamine. InChIKey: ZBZDHTYGXGTACO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6FN3O2
Molecular weight171.13 g/mol
IUPAC name4-fluoro-3-nitrobenzene-1,2-diamine
InChIKeyZBZDHTYGXGTACO-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1N)N)[N+](=O)[O-])F

Computed by PubChem (NCBI)