CAS 147285-79-8 is the registry number for 4-fluoro-3-nitro-benzene-1,2-diamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-fluoro-3-nitrobenzene-1,2-diamine (CAS 147285-79-8) is a chemical compound with the molecular formula C6H6FN3O2 and a molecular weight of 171.13 g/mol. IUPAC name: 4-fluoro-3-nitrobenzene-1,2-diamine. InChIKey: ZBZDHTYGXGTACO-UHFFFAOYSA-N.
| Molecular formula | C6H6FN3O2 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 4-fluoro-3-nitrobenzene-1,2-diamine |
| InChIKey | ZBZDHTYGXGTACO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)