cas: 383-31-3 — see every product listed under this CAS number, including other names
4-Fluoro-N,N-dimethylbenzenesulfonamide 95% (CAS 383-31-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190952-250mg |
| cas | 383-31-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 25g | 1722.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A190952 |
4-fluoro-N,N-dimethylbenzenesulfonamide (CAS 383-31-3) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 4-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: WURMPFYVFDHATI-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO2S |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | WURMPFYVFDHATI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)