cas: 351-09-7 — see every product listed under this CAS number, including other names
4-Fluoroisonitrosoacetanilide (CAS 351-09-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006251-1G |
| cas | 351-09-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 518.59 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Fluorochem | 100g | 4423.46 Pln |
| delivery time | 2-3 weeks |
|---|
(2E)-N-(4-fluorophenyl)-2-hydroxyiminoacetamide (CAS 351-09-7) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: (2E)-N-(4-fluorophenyl)-2-hydroxyiminoacetamide. InChIKey: DXSBFTGUEOWLSD-BJMVGYQFSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (2E)-N-(4-fluorophenyl)-2-hydroxyiminoacetamide |
| InChIKey | DXSBFTGUEOWLSD-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=N/O)F |
Computed by PubChem (NCBI)