CAS 1860028-18-7 appears in our catalog under these names: 6-Fluoro-5-nitro-2,3-dihydro-1h-indole, 95%, 6-Fluoro-5-nitroindoline, 97%, 6-FLUORO-5-NITRO-2,3-DIHYDRO-1H-INDOLE, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
6-fluoro-5-nitro-2,3-dihydro-1H-indole (CAS 1860028-18-7) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 6-fluoro-5-nitro-2,3-dihydro-1H-indole. InChIKey: JDSAQRIJNJOSPY-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 6-fluoro-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | JDSAQRIJNJOSPY-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)[N+](=O)[O-])F |
Computed by PubChem (NCBI)