CAS 1167056-12-3 appears in our catalog under these names: 4-Fluoro-7-nitro-2,3-dihydro-1h-indole, 95%, 4-Fluoro-7-nitro-2,3-dihydro-1H-indole, 4-Fluoro-7-nitroindoline, 98%, 98%, 4-Fluoro-7-nitro-indoline, 97%, 4-Fluoro-7-nitroindoline, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
4-fluoro-7-nitro-2,3-dihydro-1H-indole (CAS 1167056-12-3) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 4-fluoro-7-nitro-2,3-dihydro-1H-indole. InChIKey: PAVIDRYITUVQFL-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-fluoro-7-nitro-2,3-dihydro-1H-indole |
| InChIKey | PAVIDRYITUVQFL-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C21)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)