cas: 1073354-66-1 — see every product listed under this CAS number, including other names
4-Formyl-2-methylphenylboronic acid pinacol ester, 98%, 98% (CAS 1073354-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JPQ-100mg |
| cas | 1073354-66-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Chemat | 5g | 1370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1073354-66-1) is a chemical compound with the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. IUPAC name: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: JUFVNKBJTLKQGA-UHFFFAOYSA-N.
| Molecular formula | C14H19BO3 |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | JUFVNKBJTLKQGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C=O)C |
Computed by PubChem (NCBI)