cas: 128376-64-7 — see every product listed under this CAS number, including other names
4-Formylphenylboronic acid pinacol cyclic ester, 98%, 98% (CAS 128376-64-7) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111Y2J-5kg |
| cas | 128376-64-7 |
| size | 5kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 11539.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 251.60 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 250g | 942.80 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 128376-64-7) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: DMBMXJJGPXADPO-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | DMBMXJJGPXADPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)