cas: 128376-64-7 — see every product listed under this CAS number, including other names
4-Formylphenylboronic acid pinacol ester, 97% (CAS 128376-64-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 445040050 |
| cas | 128376-64-7 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 316.71 Pln | |
| Thermo Scientific (Acros) | 25g | 1033.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 128376-64-7) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: DMBMXJJGPXADPO-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | DMBMXJJGPXADPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)