cas: 90151-04-5 — see every product listed under this CAS number, including other names
4-Hydroxy-2-nitrobenzaldehyde, 95% (CAS 90151-04-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F455357-250MG |
| cas | 90151-04-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 3345.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-hydroxy-2-nitrobenzaldehyde (CAS 90151-04-5) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 4-hydroxy-2-nitrobenzaldehyde. InChIKey: PTVFUHTYJLKEDZ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 4-hydroxy-2-nitrobenzaldehyde |
| InChIKey | PTVFUHTYJLKEDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)