cas: 10537-86-7 — see every product listed under this CAS number, including other names
4-Hydroxy-3,5-bis(isopropyl)benzaldehyde 97% (CAS 10537-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183601-100mg |
| cas | 10537-86-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 448.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A183601 |
4-hydroxy-3,5-di(propan-2-yl)benzaldehyde (CAS 10537-86-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 4-hydroxy-3,5-di(propan-2-yl)benzaldehyde. InChIKey: WVGDLTQPAQUBMO-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-hydroxy-3,5-di(propan-2-yl)benzaldehyde |
| InChIKey | WVGDLTQPAQUBMO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C=O |
Computed by PubChem (NCBI)