cas: 3011-34-5 — see every product listed under this CAS number, including other names
4-Hydroxy-3-nitrobenzaldehyde, 97%, 97% (CAS 3011-34-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 5kg, 10g, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LI6-5g |
| cas | 3011-34-5 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 446.40 Pln | |
| Chemat | 1kg | 808.40 Pln | |
| Chemat | 5kg | 3417.60 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-3-nitrobenzaldehyde (CAS 3011-34-5) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzaldehyde. InChIKey: YTHJCZRFJGXPTL-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 4-hydroxy-3-nitrobenzaldehyde |
| InChIKey | YTHJCZRFJGXPTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)