cas: 3011-34-5 — see every product listed under this CAS number, including other names
4-Hydroxy-3-nitrobenzaldehyde, 97% (CAS 3011-34-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 162890050 |
| cas | 3011-34-5 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 213.37 Pln | |
| Thermo Scientific (Acros) | 25g | 699.35 Pln | |
| Sigma-Aldrich | 25G | 877.00 Pln | |
| Sigma-Aldrich | 5G | 390.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-hydroxy-3-nitrobenzaldehyde (CAS 3011-34-5) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzaldehyde. InChIKey: YTHJCZRFJGXPTL-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 4-hydroxy-3-nitrobenzaldehyde |
| InChIKey | YTHJCZRFJGXPTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)