cas: 2496-15-3 — see every product listed under this CAS number, including other names
4-Hydroxy-4'-dimethylaminoazobenzene, >98.0%(HPLC)(T) (CAS 2496-15-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0237-1G |
| cas | 2496-15-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 152.77 Pln | |
| TCI | 25g | 1465.67 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-[[4-(dimethylamino)phenyl]diazenyl]phenol (CAS 2496-15-3) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]phenol. InChIKey: CQKQINNUKSBEQR-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]phenol |
| InChIKey | CQKQINNUKSBEQR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)