CAS 7696-70-0 appears in our catalog under these names: 4-Dimethylamino-4'-nitrosodiphenylamine, 95%, N1,N1-Dimethyl-N4-(4-nitrosophenyl)benzene-1,4-diamine, 96%, 4–(Dimethylamino)–4'–nitrosodiphenylamine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 1g, 250mg.
4-N,4-N-dimethyl-1-N-(4-nitrosophenyl)benzene-1,4-diamine (CAS 7696-70-0) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 4-N,4-N-dimethyl-1-N-(4-nitrosophenyl)benzene-1,4-diamine. InChIKey: RCBYEFZWZHPVCN-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 4-N,4-N-dimethyl-1-N-(4-nitrosophenyl)benzene-1,4-diamine |
| InChIKey | RCBYEFZWZHPVCN-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC2=CC=C(C=C2)N=O |
Computed by PubChem (NCBI)