CAS 1018564-07-2 appears in our catalog under these names: 4-Amino-3-methyl-n-(3-pyridinylmethyl)benzamide, 95%, 4–Amino–3–methyl–N–(3–pyridylmethyl)benzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
4-amino-3-methyl-N-(pyridin-3-ylmethyl)benzamide (CAS 1018564-07-2) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 4-amino-3-methyl-N-(pyridin-3-ylmethyl)benzamide. InChIKey: HTFPDOYAARYLEZ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 4-amino-3-methyl-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | HTFPDOYAARYLEZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NCC2=CN=CC=C2)N |
Computed by PubChem (NCBI)