cas: 49713-51-1 — see every product listed under this CAS number, including other names
4-Hydroxy-6-(Trifluoromethyl)Quinoline, 96%, 96% (CAS 49713-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LIH-1g |
| cas | 49713-51-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 390.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-1H-quinolin-4-one (CAS 49713-51-1) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: CEIVPELVRVTMJW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | CEIVPELVRVTMJW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)C=CN2 |
Computed by PubChem (NCBI)