cas: 49713-51-1 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)-4-quinolinol, 96% (CAS 49713-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007673-1G |
| cas | 49713-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 279.09 Pln | |
| Fluorochem | 25g | 607.10 Pln | |
| Fluorochem | 100g | 2262.76 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-(trifluoromethyl)-1H-quinolin-4-one (CAS 49713-51-1) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: CEIVPELVRVTMJW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | CEIVPELVRVTMJW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)C=CN2 |
Computed by PubChem (NCBI)