cas: 175203-86-8 — see every product listed under this CAS number, including other names
4-Hydroxy-6-(trifluoromethoxy)quinoline-3-carboxylic acid, 97% (CAS 175203-86-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 50g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | KM09299DA |
| cas | 175203-86-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 117.60 Pln | |
| Thermo Scientific | 10g | 621.08 Pln | |
| Thermo Scientific | 50g | 1970.14 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-oxo-6-(trifluoromethoxy)-1H-quinoline-3-carboxylic acid (CAS 175203-86-8) is a chemical compound with the molecular formula C11H6F3NO4 and a molecular weight of 273.16 g/mol. IUPAC name: 4-oxo-6-(trifluoromethoxy)-1H-quinoline-3-carboxylic acid. InChIKey: GSUDZUNGTZIKPY-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO4 |
|---|---|
| Molecular weight | 273.16 g/mol |
| IUPAC name | 4-oxo-6-(trifluoromethoxy)-1H-quinoline-3-carboxylic acid |
| InChIKey | GSUDZUNGTZIKPY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)