Products 2228313-88-8

CAS 2228313-88-8 is the registry number for 5-(2-(Trifluoromethoxy)phenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylic acid (CAS 2228313-88-8) is a chemical compound with the molecular formula C11H6F3NO4 and a molecular weight of 273.16 g/mol. IUPAC name: 5-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylic acid. InChIKey: HTZOYNFGOMPXNL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO4
Molecular weight273.16 g/mol
IUPAC name5-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylic acid
InChIKeyHTZOYNFGOMPXNL-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=NO2)C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)