CAS 369631-68-5 appears in our catalog under these names: Bragsin1, Bragsin1, 99+%, Bragsin1, 99.40%, 99.40%, Bragsin1, 99.91%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 10mg, 10mM (in 1ml dmso), 50mg, 1mg, 100 mg, 5 mg.
6-methyl-5-nitro-2-(trifluoromethyl)chromen-4-one (CAS 369631-68-5) is a chemical compound with the molecular formula C11H6F3NO4 and a molecular weight of 273.16 g/mol. IUPAC name: 6-methyl-5-nitro-2-(trifluoromethyl)chromen-4-one. InChIKey: WEUSXIBCGCFOQR-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO4 |
|---|---|
| Molecular weight | 273.16 g/mol |
| IUPAC name | 6-methyl-5-nitro-2-(trifluoromethyl)chromen-4-one |
| InChIKey | WEUSXIBCGCFOQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)OC(=CC2=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)