CAS 38861-88-0 appears in our catalog under these names: Ibuprofen Impurity 11, 4-Isobutylbenzoic Acid, 4–Isobutylbenzoic Acid, 4-Isobutylbenzoic Acid, >99.0%(GC)(T), 4-Isobutylbenzoic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 1g, 250mg, 5g, 25mg, 100mg, 10g, 25g.
4-(2-methylpropyl)benzoic acid (CAS 38861-88-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 4-(2-methylpropyl)benzoic acid. InChIKey: VUBBCFWWSKOHTH-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-(2-methylpropyl)benzoic acid |
| InChIKey | VUBBCFWWSKOHTH-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)