CAS 100256-93-7 appears in our catalog under these names: 4-Isopropoxy-2,6-dimethylbenzoic acid, 95%, 4–Isopropoxy–2,6–dimethylbenzoic acid, 4-Isopropoxy-2,6-dimethylbenzoic acid, 95+%, 95+%, 4-Isopropoxy-2,6-dimethylbenzoic acid, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,6-dimethyl-4-propan-2-yloxybenzoic acid (CAS 100256-93-7) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,6-dimethyl-4-propan-2-yloxybenzoic acid. InChIKey: LSSLZIWTSGVMCL-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2,6-dimethyl-4-propan-2-yloxybenzoic acid |
| InChIKey | LSSLZIWTSGVMCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)OC(C)C |
Computed by PubChem (NCBI)