cas: 51908-29-3 — see every product listed under this CAS number, including other names
4-Isothiocyanatobenzenesulfonamide, 95%+(NMR),RG, 95%+(NMR),RG (CAS 51908-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBOA-100mg |
| cas | 51908-29-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 1192.40 Pln | |
| Chemat | 25g | 5051.60 Pln |
| purity | 95%+(NMR),RG |
|---|---|
| delivery time | 3 weeks |
4-isothiocyanatobenzenesulfonamide (CAS 51908-29-3) is a chemical compound with the molecular formula C7H6N2O2S2 and a molecular weight of 214.3 g/mol. IUPAC name: 4-isothiocyanatobenzenesulfonamide. InChIKey: IMDUFDNFSJWYQT-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S2 |
|---|---|
| Molecular weight | 214.3 g/mol |
| IUPAC name | 4-isothiocyanatobenzenesulfonamide |
| InChIKey | IMDUFDNFSJWYQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)S(=O)(=O)N |
Computed by PubChem (NCBI)