Products 70604-07-8
CAS 70604-07-8 is the registry number for 7-Hydroxy-2-(methylthio)thiazolo[4,5-b]pyridin-5(4H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-hydroxy-2-methylsulfanyl-4H-[1,3]thiazolo[4,5-b]pyridin-5-one (CAS 70604-07-8) is a chemical compound with the molecular formula C7H6N2O2S2 and a molecular weight of 214.3 g/mol. IUPAC name: 7-hydroxy-2-methylsulfanyl-4H-[1,3]thiazolo[4,5-b]pyridin-5-one. InChIKey: RUOALCWXNCAECA-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S2 |
|---|---|
| Molecular weight | 214.3 g/mol |
| IUPAC name | 7-hydroxy-2-methylsulfanyl-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
| InChIKey | RUOALCWXNCAECA-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C(=CC(=O)N2)O |
Computed by PubChem (NCBI)