cas: 96345-79-8 — see every product listed under this CAS number, including other names
4-Isothiocyanatophenyl α-D-Mannopyranoside 97% (CAS 96345-79-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1339416-25mg |
| cas | 96345-79-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 915.50 Pln | |
| Ambeed | 50mg | 1176.94 Pln | |
| Ambeed | 100mg | 1521.81 Pln | |
| Ambeed | 250mg | 1972.38 Pln | |
| Ambeed | 1g | 4792.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1339416 |
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol (CAS 96345-79-8) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol. InChIKey: RWANFUZQWINQBY-BNDIWNMDSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol |
| InChIKey | RWANFUZQWINQBY-BNDIWNMDSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)