cas: 96345-79-8 — see every product listed under this CAS number, including other names
4-Isothiocyanatophenyl α-D-Mannopyranoside, 99.87% (CAS 96345-79-8) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10mM/1mL, 25 mg, 100 mg, 5 mg, 10 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-132996-50 mg |
| cas | 96345-79-8 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 1559.64 Pln | |
| MedChemExpress | 10mM/1mL | 435.79 Pln | |
| MedChemExpress | 25 mg | 1030.22 Pln | |
| MedChemExpress | 100 mg | 2423.42 Pln | |
| MedChemExpress | 5 mg | 407.93 Pln | |
| MedChemExpress | 10 mg | 575.11 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.87% |
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol (CAS 96345-79-8) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol. InChIKey: RWANFUZQWINQBY-BNDIWNMDSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol |
| InChIKey | RWANFUZQWINQBY-BNDIWNMDSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)