cas: 96345-79-8 — see every product listed under this CAS number, including other names
alpha-D-Mannopyranosylphenyl isothiocyanate, 95.00% (CAS 96345-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 25mg, 500mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM99890C-100mg |
| cas | 96345-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2864.20 Pln | |
| Chemat | 250mg | 5348.37 Pln | |
| Chemat | 25mg | 1331.35 Pln | |
| Chemat | 500mg | 8288.30 Pln | |
| Chemat | 50mg | 1874.70 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 95.00% |
| category | Chemicals |
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol (CAS 96345-79-8) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol. InChIKey: RWANFUZQWINQBY-BNDIWNMDSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol |
| InChIKey | RWANFUZQWINQBY-BNDIWNMDSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)