cas: 31872-61-4 — see every product listed under this CAS number, including other names
4-Methoxy-3-nitropyridine hydrochloride 98% (CAS 31872-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A297617-1g |
| cas | 31872-61-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 587.31 Pln | |
| Ambeed | 25g | 2211.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A297617 |
4-methoxy-3-nitropyridine;hydrochloride (CAS 31872-61-4) is a chemical compound with the molecular formula C6H7ClN2O3 and a molecular weight of 190.58 g/mol. IUPAC name: 4-methoxy-3-nitropyridine;hydrochloride. InChIKey: RRJVDMBZMAGZGE-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O3 |
|---|---|
| Molecular weight | 190.58 g/mol |
| IUPAC name | 4-methoxy-3-nitropyridine;hydrochloride |
| InChIKey | RRJVDMBZMAGZGE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=NC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)