cas: 31872-61-4 — see every product listed under this CAS number, including other names
4-Methoxy-3-nitropyridine hydrochloride, 98%, 98% (CAS 31872-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118I79-1g |
| cas | 31872-61-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 693.20 Pln | |
| Chemat | 25g | 2584.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-3-nitropyridine;hydrochloride (CAS 31872-61-4) is a chemical compound with the molecular formula C6H7ClN2O3 and a molecular weight of 190.58 g/mol. IUPAC name: 4-methoxy-3-nitropyridine;hydrochloride. InChIKey: RRJVDMBZMAGZGE-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O3 |
|---|---|
| Molecular weight | 190.58 g/mol |
| IUPAC name | 4-methoxy-3-nitropyridine;hydrochloride |
| InChIKey | RRJVDMBZMAGZGE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=NC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)