cas: 1072811-67-6 — see every product listed under this CAS number, including other names
4-Methoxycarbonylindole-2-boronic acid pinacol ester, 95%, 95% (CAS 1072811-67-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118T8T-250mg |
| cas | 1072811-67-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 5g | 10960.40 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 1g | 2243.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate (CAS 1072811-67-6) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate. InChIKey: DBUOXHIKCAIAHS-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate |
| InChIKey | DBUOXHIKCAIAHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC=C3N2)C(=O)OC |
Computed by PubChem (NCBI)