cas: 2872-65-3 — see every product listed under this CAS number, including other names
4-Methoxyphenyl β-D-galactopyranoside 2,3,4,6-tetraacetate (CAS 2872-65-3) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W039919-5 g |
| cas | 2872-65-3 |
| size | 5 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 435.79 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 10 g | 621.55 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | no data |
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (CAS 2872-65-3) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: RPHXBVOPPUTUES-XDWAVFMPSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | RPHXBVOPPUTUES-XDWAVFMPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)