cas: 2872-65-3 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 2,3,4,6-Tetra-O-acetyl-beta-D-galactopyranoside, 98%, 98% (CAS 2872-65-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WA9-1g |
| cas | 2872-65-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (CAS 2872-65-3) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: RPHXBVOPPUTUES-XDWAVFMPSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | RPHXBVOPPUTUES-XDWAVFMPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)