cas: 2872-65-3 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside (CAS 2872-65-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM75000C-10g |
| cas | 2872-65-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1631.80 Pln | |
| Chemat | 25g | 2967.60 Pln | |
| Chemat | 50g | 4846.32 Pln | |
| Chemat | 5g | 1186.98 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (CAS 2872-65-3) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: RPHXBVOPPUTUES-XDWAVFMPSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | RPHXBVOPPUTUES-XDWAVFMPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)