cas: 4053-40-1 — see every product listed under this CAS number, including other names
4-Methyl-1-oxidoquinolin-1-ium, >97%, >97% (CAS 4053-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D6YK-100mg |
| cas | 4053-40-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 3635.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-methyl-1-oxidoquinolin-1-ium (CAS 4053-40-1) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 4-methyl-1-oxidoquinolin-1-ium. InChIKey: BKKKHCJYHYPKBC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 4-methyl-1-oxidoquinolin-1-ium |
| InChIKey | BKKKHCJYHYPKBC-UHFFFAOYSA-N |
| SMILES | CC1=CC=[N+](C2=CC=CC=C12)[O-] |
Computed by PubChem (NCBI)