cas: 1249834-47-6 — see every product listed under this CAS number, including other names
4-Methyl-2-phenyl-1,3-thiazol-5-amine, 95%, 95% (CAS 1249834-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A7JD-100mg |
| cas | 1249834-47-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 5498.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-phenyl-1,3-thiazol-5-amine (CAS 1249834-47-6) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-thiazol-5-amine. InChIKey: LYUISGYCYRYZPX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-thiazol-5-amine |
| InChIKey | LYUISGYCYRYZPX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)