cas: 34418-48-9 — see every product listed under this CAS number, including other names
4-Methyl-2-pyridin-2-yl-thiazole-5-carboxylic acid, 97% (CAS 34418-48-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059477-5G |
| cas | 34418-48-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1596.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 34418-48-9) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: QFDHWPOPCNNAOI-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QFDHWPOPCNNAOI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)