cas: 13480-37-0 — see every product listed under this CAS number, including other names
4-Methyl-3-phenylaniline, 95%, 95% (CAS 13480-37-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AJBX-250mg |
| cas | 13480-37-0 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1053.20 Pln | |
| Chemat | 5g | 5013.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-3-phenylaniline (CAS 13480-37-0) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-methyl-3-phenylaniline. InChIKey: COYWNBKOPFAEDG-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-methyl-3-phenylaniline |
| InChIKey | COYWNBKOPFAEDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)