cas: 7403-42-1 — see every product listed under this CAS number, including other names
4-Methyl-4-phenylpentan-2-one, ≥95%, ≥95% (CAS 7403-42-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119PBO-250mg |
| cas | 7403-42-1 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 914.00 Pln | |
| Chemat | 5g | 3016.40 Pln | |
| Chemat | 25g | 10341.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-4-phenylpentan-2-one (CAS 7403-42-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 4-methyl-4-phenylpentan-2-one. InChIKey: PFDVPCSDZXZDMF-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 4-methyl-4-phenylpentan-2-one |
| InChIKey | PFDVPCSDZXZDMF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)